About 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine
4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 155950676) has the molecular formula C15H11N7O2S
and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 155950676 |
| Molecular Formula | C15H11N7O2S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1nc(Sc2nnnn2-c2ccc3c(c2)OCO3)c2cc[nH]c2n1 |
| InChI | InChI=1S/C15H11N7O2S/c1-8-17-13-10(4-5-16-13)14(18-8)25-15-19-20-21-22(15)9-2-3-11-12(6-9)24-7-23-11/h2-6H,7H2,1H3,(H,16,17,18) |
| InChIKey | VPZZCQVJPLHBPE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine (CID 155950676) is 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine is Cc1nc(Sc2nnnn2-c2ccc3c(c2)OCO3)c2cc[nH]c2n1.
What is the InChIKey of 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is VPZZCQVJPLHBPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N7O2S/c1-8-17-13-10(4-5-16-13)14(18-8)25-15-19-20-21-22(15)9-2-3-11-12(6-9)24-7-23-11/h2-6H,7H2,1H3,(H,16,17,18).
What are the key properties of 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine?
4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 353.37 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]sulfanyl-2-methyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 155950676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).