C18H25N3O2 — CID 155951941
2-[benzyl-[(3-piperidin-4-yl-1,2-oxazol-5-yl)methyl]amino]ethanol (PubChem CID 155951941) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[benzyl-[(3-piperidin-4-yl-1,2-oxazol-5-yl)methyl]amino]ethanol.
| Compound Name | 2-[benzyl-[(3-piperidin-4-yl-1,2-oxazol-5-yl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 155951941 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-[benzyl-[(3-piperidin-4-yl-1,2-oxazol-5-yl)methyl]amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)Cc1cc(C2CCNCC2)no1 |
| InChI | InChI=1S/C18H25N3O2/c22-11-10-21(13-15-4-2-1-3-5-15)14-17-12-18(20-23-17)16-6-8-19-9-7-16/h1-5,12,16,19,22H,6-11,13-14H2 |
| InChIKey | BRQIMYQTUJJHQW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |