C19H24N4O — CID 155952998
(4R,6R)-4-methoxy-8-[(2-methyl-3-pyridinyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene (PubChem CID 155952998) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (4R,6R)-4-methoxy-8-[(2-methyl-3-pyridinyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene.
| Compound Name | (4R,6R)-4-methoxy-8-[(2-methyl-3-pyridinyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene |
|---|---|
| PubChem CID | 155952998 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (4R,6R)-4-methoxy-8-[(2-methyl-3-pyridinyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene |
| SMILES | CO[C@@H]1C[C@@H]2CN(Cc3cccnc3C)Cc3cccnc3N2C1 |
| InChI | InChI=1S/C19H24N4O/c1-14-15(5-3-7-20-14)10-22-11-16-6-4-8-21-19(16)23-13-18(24-2)9-17(23)12-22/h3-8,17-18H,9-13H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | WDKMVSLFPUBDJG-QZTJIDSGSA-N |
| XLogP | 2.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |