C22H24BrN7O2 — CID 155967891
N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-methoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide (PubChem CID 155967891) has the molecular formula C22H24BrN7O2 and a molecular weight of 498.39 g/mol. Its IUPAC name is N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-methoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide.
| Compound Name | N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-methoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
|---|---|
| PubChem CID | 155967891 |
| Molecular Formula | C22H24BrN7O2 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-[[3-(4-bromophenyl)-1H-1,2,4-triazol-5-yl]methyl]-4-methoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
| SMILES | COC1CC2CN(C(=O)NCc3nc(-c4ccc(Br)cc4)n[nH]3)Cc3cccnc3N2C1 |
| InChI | InChI=1S/C22H24BrN7O2/c1-32-18-9-17-12-29(11-15-3-2-8-24-21(15)30(17)13-18)22(31)25-10-19-26-20(28-27-19)14-4-6-16(23)7-5-14/h2-8,17-18H,9-13H2,1H3,(H,25,31)(H,26,27,28) |
| InChIKey | NUQIYFHBMSWWBC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |