C19H28N4O2 — CID 138019246
(6R)-N-[(1-methoxycyclopentyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide (PubChem CID 138019246) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (6R)-N-[(1-methoxycyclopentyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide.
| Compound Name | (6R)-N-[(1-methoxycyclopentyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
|---|---|
| PubChem CID | 138019246 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (6R)-N-[(1-methoxycyclopentyl)methyl]-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
| SMILES | COC1(CNC(=O)N2Cc3cccnc3N3CCC[C@@H]3C2)CCCC1 |
| InChI | InChI=1S/C19H28N4O2/c1-25-19(8-2-3-9-19)14-21-18(24)22-12-15-6-4-10-20-17(15)23-11-5-7-16(23)13-22/h4,6,10,16H,2-3,5,7-9,11-14H2,1H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | JTGVIAFKDFTSJA-MRXNPFEDSA-N |
| XLogP | 2.53 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |