C16H18N4O2S — CID 138022215
(3-methoxy-1,2-thiazol-5-yl)-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]methanone (PubChem CID 138022215) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is (3-methoxy-1,2-thiazol-5-yl)-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]methanone.
| Compound Name | (3-methoxy-1,2-thiazol-5-yl)-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]methanone |
|---|---|
| PubChem CID | 138022215 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3-methoxy-1,2-thiazol-5-yl)-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]methanone |
| SMILES | COc1cc(C(=O)N2Cc3ncccc3N3CCC[C@H]3C2)sn1 |
| InChI | InChI=1S/C16H18N4O2S/c1-22-15-8-14(23-18-15)16(21)19-9-11-4-3-7-20(11)13-5-2-6-17-12(13)10-19/h2,5-6,8,11H,3-4,7,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | ISFVQAQUCCBCEP-NSHDSACASA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |