C17H20N6O2 — CID 138019263
(6S)-N-[(6-oxo-1H-pyridazin-3-yl)methyl]-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide (PubChem CID 138019263) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is (6S)-N-[(6-oxo-1H-pyridazin-3-yl)methyl]-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide.
| Compound Name | (6S)-N-[(6-oxo-1H-pyridazin-3-yl)methyl]-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
|---|---|
| PubChem CID | 138019263 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (6S)-N-[(6-oxo-1H-pyridazin-3-yl)methyl]-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
| SMILES | O=C(NCc1ccc(=O)[nH]n1)N1Cc2ncccc2N2CCC[C@H]2C1 |
| InChI | InChI=1S/C17H20N6O2/c24-16-6-5-12(20-21-16)9-19-17(25)22-10-13-3-2-8-23(13)15-4-1-7-18-14(15)11-22/h1,4-7,13H,2-3,8-11H2,(H,19,25)(H,21,24)/t13-/m0/s1 |
| InChIKey | XPGAUIHQTGOKMJ-ZDUSSCGKSA-N |
| XLogP | 0.86 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |