C16H24N4O2S — CID 146139791
2-[2-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]ethyl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 146139791) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-[2-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]ethyl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[2-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]ethyl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 146139791 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[2-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]ethyl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1CCN1Cc2ncccc2N2CCC[C@H]2C1 |
| InChI | InChI=1S/C16H24N4O2S/c21-23(22)11-3-7-19(23)10-9-18-12-14-4-2-8-20(14)16-5-1-6-17-15(16)13-18/h1,5-6,14H,2-4,7-13H2/t14-/m0/s1 |
| InChIKey | LKOHFJNURCRFNC-AWEZNQCLSA-N |
| XLogP | 0.90 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |