C16H19N5O2 — CID 138022220
3-methyl-4-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carbonyl]-1H-imidazol-2-one (PubChem CID 138022220) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-methyl-4-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carbonyl]-1H-imidazol-2-one.
| Compound Name | 3-methyl-4-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carbonyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 138022220 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-methyl-4-[(6S)-2,8,11-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carbonyl]-1H-imidazol-2-one |
| SMILES | Cn1c(C(=O)N2Cc3ncccc3N3CCC[C@H]3C2)c[nH]c1=O |
| InChI | InChI=1S/C16H19N5O2/c1-19-14(8-18-16(19)23)15(22)20-9-11-4-3-7-21(11)13-5-2-6-17-12(13)10-20/h2,5-6,8,11H,3-4,7,9-10H2,1H3,(H,18,23)/t11-/m0/s1 |
| InChIKey | KWAVFXXCEUAIMD-NSHDSACASA-N |
| XLogP | 0.73 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |