C16H22N8O — CID 167927713
(6R)-N-(2-propan-2-yltetrazol-5-yl)-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide (PubChem CID 167927713) has the molecular formula C16H22N8O and a molecular weight of 342.41 g/mol. Its IUPAC name is (6R)-N-(2-propan-2-yltetrazol-5-yl)-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide.
| Compound Name | (6R)-N-(2-propan-2-yltetrazol-5-yl)-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
|---|---|
| PubChem CID | 167927713 |
| Molecular Formula | C16H22N8O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (6R)-N-(2-propan-2-yltetrazol-5-yl)-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-triene-8-carboxamide |
| SMILES | CC(C)n1nnc(NC(=O)N2Cc3cccnc3N3CCC[C@@H]3C2)n1 |
| InChI | InChI=1S/C16H22N8O/c1-11(2)24-20-15(19-21-24)18-16(25)22-9-12-5-3-7-17-14(12)23-8-4-6-13(23)10-22/h3,5,7,11,13H,4,6,8-10H2,1-2H3,(H,18,20,25)/t13-/m1/s1 |
| InChIKey | UUBSGPFREDXAHE-CYBMUJFWSA-N |
| XLogP | 1.67 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |