C13H18F2N4 — CID 155953082
N'-(2,2-difluoroethyl)-N-(1H-indazol-7-ylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 155953082) has the molecular formula C13H18F2N4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N-(1H-indazol-7-ylmethyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-(2,2-difluoroethyl)-N-(1H-indazol-7-ylmethyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 155953082 |
| Molecular Formula | C13H18F2N4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N-(1H-indazol-7-ylmethyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNCc1cccc2cn[nH]c12)CC(F)F |
| InChI | InChI=1S/C13H18F2N4/c1-19(9-12(14)15)6-5-16-7-10-3-2-4-11-8-17-18-13(10)11/h2-4,8,12,16H,5-7,9H2,1H3,(H,17,18) |
| InChIKey | UYYWCXALFJKFRE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|