C21H25N3O — CID 155953195
2-[[4-(1H-indol-2-ylmethyl)piperazin-1-yl]methyl]-4-methylphenol (PubChem CID 155953195) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[[4-(1H-indol-2-ylmethyl)piperazin-1-yl]methyl]-4-methylphenol.
| Compound Name | 2-[[4-(1H-indol-2-ylmethyl)piperazin-1-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 155953195 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[[4-(1H-indol-2-ylmethyl)piperazin-1-yl]methyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(CN2CCN(Cc3cc4ccccc4[nH]3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O/c1-16-6-7-21(25)18(12-16)14-23-8-10-24(11-9-23)15-19-13-17-4-2-3-5-20(17)22-19/h2-7,12-13,22,25H,8-11,14-15H2,1H3 |
| InChIKey | YTBYANFKLKZTNF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|