C13H17N3O2 — CID 155955747
(3S)-3-(2-methylpropyl)-6-pyridin-3-ylpiperazine-2,5-dione (PubChem CID 155955747) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (3S)-3-(2-methylpropyl)-6-pyridin-3-ylpiperazine-2,5-dione.
| Compound Name | (3S)-3-(2-methylpropyl)-6-pyridin-3-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 155955747 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (3S)-3-(2-methylpropyl)-6-pyridin-3-ylpiperazine-2,5-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)C(c2cccnc2)NC1=O |
| InChI | InChI=1S/C13H17N3O2/c1-8(2)6-10-12(17)16-11(13(18)15-10)9-4-3-5-14-7-9/h3-5,7-8,10-11H,6H2,1-2H3,(H,15,18)(H,16,17)/t10-,11?/m0/s1 |
| InChIKey | WCZQKWDLMNAUAP-VUWPPUDQSA-N |
| XLogP | 0.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |