C19H23FN2O3 — CID 155958141
N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(oxan-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 155958141) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(oxan-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(oxan-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 155958141 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)-3-(oxan-4-yl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NC1CCCc2cc(F)ccc21)C1CC(C2CCOCC2)=NO1 |
| InChI | InChI=1S/C19H23FN2O3/c20-14-4-5-15-13(10-14)2-1-3-16(15)21-19(23)18-11-17(22-25-18)12-6-8-24-9-7-12/h4-5,10,12,16,18H,1-3,6-9,11H2,(H,21,23) |
| InChIKey | ZXEITFJICYXQBB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |