C15H15BrN2S — CID 155960973
3-[1-[2-(2-bromothiophen-3-yl)ethylamino]ethyl]benzonitrile (PubChem CID 155960973) has the molecular formula C15H15BrN2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 3-[1-[2-(2-bromothiophen-3-yl)ethylamino]ethyl]benzonitrile.
| Compound Name | 3-[1-[2-(2-bromothiophen-3-yl)ethylamino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 155960973 |
| Molecular Formula | C15H15BrN2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 3-[1-[2-(2-bromothiophen-3-yl)ethylamino]ethyl]benzonitrile |
| SMILES | CC(NCCc1ccsc1Br)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H15BrN2S/c1-11(14-4-2-3-12(9-14)10-17)18-7-5-13-6-8-19-15(13)16/h2-4,6,8-9,11,18H,5,7H2,1H3 |
| InChIKey | GAGOMPABSVSSBA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |