C24H24N6O — CID 155966979
1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-[[4-(pyridin-4-ylamino)phenyl]methyl]urea (PubChem CID 155966979) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-[[4-(pyridin-4-ylamino)phenyl]methyl]urea.
| Compound Name | 1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-[[4-(pyridin-4-ylamino)phenyl]methyl]urea |
|---|---|
| PubChem CID | 155966979 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3-[[4-(pyridin-4-ylamino)phenyl]methyl]urea |
| SMILES | Cn1cc(-c2ccc(CNC(=O)NCc3ccc(Nc4ccncc4)cc3)cc2)cn1 |
| InChI | InChI=1S/C24H24N6O/c1-30-17-21(16-28-30)20-6-2-18(3-7-20)14-26-24(31)27-15-19-4-8-22(9-5-19)29-23-10-12-25-13-11-23/h2-13,16-17H,14-15H2,1H3,(H,25,29)(H2,26,27,31) |
| InChIKey | ARCRAPQNIKTFAZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |