C22H20N4O3 — CID 167770744
4-(2,5-dioxopyrrolidin-1-yl)-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]benzamide (PubChem CID 167770744) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 167770744 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]benzamide |
| SMILES | Cn1cc(-c2ccc(CNC(=O)c3ccc(N4C(=O)CCC4=O)cc3)cc2)cn1 |
| InChI | InChI=1S/C22H20N4O3/c1-25-14-18(13-24-25)16-4-2-15(3-5-16)12-23-22(29)17-6-8-19(9-7-17)26-20(27)10-11-21(26)28/h2-9,13-14H,10-12H2,1H3,(H,23,29) |
| InChIKey | QZRSPPQEQIAXEG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|