C24H18ClN5O — CID 155968125
1-[[4-(benzimidazol-1-yl)-2-chlorophenyl]methyl]-3-quinolin-3-ylurea (PubChem CID 155968125) has the molecular formula C24H18ClN5O and a molecular weight of 427.90 g/mol. Its IUPAC name is 1-[[4-(benzimidazol-1-yl)-2-chlorophenyl]methyl]-3-quinolin-3-ylurea.
| Compound Name | 1-[[4-(benzimidazol-1-yl)-2-chlorophenyl]methyl]-3-quinolin-3-ylurea |
|---|---|
| PubChem CID | 155968125 |
| Molecular Formula | C24H18ClN5O |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-[[4-(benzimidazol-1-yl)-2-chlorophenyl]methyl]-3-quinolin-3-ylurea |
| SMILES | O=C(NCc1ccc(-n2cnc3ccccc32)cc1Cl)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C24H18ClN5O/c25-20-12-19(30-15-28-22-7-3-4-8-23(22)30)10-9-17(20)13-27-24(31)29-18-11-16-5-1-2-6-21(16)26-14-18/h1-12,14-15H,13H2,(H2,27,29,31) |
| InChIKey | LUPNZDXERGQDEX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |