C18H24BrN3O2 — CID 155969320
1-[2-[(3-bromophenyl)methyl-ethylamino]ethyl]-3-[2-(furan-3-yl)ethyl]urea (PubChem CID 155969320) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is 1-[2-[(3-bromophenyl)methyl-ethylamino]ethyl]-3-[2-(furan-3-yl)ethyl]urea.
| Compound Name | 1-[2-[(3-bromophenyl)methyl-ethylamino]ethyl]-3-[2-(furan-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 155969320 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-[2-[(3-bromophenyl)methyl-ethylamino]ethyl]-3-[2-(furan-3-yl)ethyl]urea |
| SMILES | CCN(CCNC(=O)NCCc1ccoc1)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H24BrN3O2/c1-2-22(13-16-4-3-5-17(19)12-16)10-9-21-18(23)20-8-6-15-7-11-24-14-15/h3-5,7,11-12,14H,2,6,8-10,13H2,1H3,(H2,20,21,23) |
| InChIKey | MIHNISRXPLWWMI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |