C8H5Cl2F3N4S3 — CID 155969931
5-[(3,4-dichloro-1,2-thiazol-5-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 155969931) has the molecular formula C8H5Cl2F3N4S3 and a molecular weight of 381.26 g/mol. Its IUPAC name is 5-[(3,4-dichloro-1,2-thiazol-5-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3,4-dichloro-1,2-thiazol-5-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 155969931 |
| Molecular Formula | C8H5Cl2F3N4S3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | 5-[(3,4-dichloro-1,2-thiazol-5-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)CNc1nnc(SCc2snc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C8H5Cl2F3N4S3/c9-4-3(20-17-5(4)10)1-18-7-16-15-6(19-7)14-2-8(11,12)13/h1-2H2,(H,14,15) |
| InChIKey | HWVQQQBRIIYTDU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |