(4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride

C10H10ClNO — CID 155970403

IUPAC(4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride
SMILESO/N=C(\Cl)c1cccc2c1CCC2
InChIInChI=1S/C10H10ClNO/c11-10(12-13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,13H,1,3,5H2/b12-10-
InChIKeyWOFSWYCNKCLMSP-BENRWUELSA-N
MW195.65 g/mol
LogP2.55
Rot. Bonds1

About (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride

(4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride (PubChem CID 155970403) has the molecular formula C10H10ClNO and a molecular weight of 195.65 g/mol. Its IUPAC name is (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride.

Molecular Properties

Compound Name(4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride
PubChem CID155970403
Molecular FormulaC10H10ClNO
Molecular Weight195.65 g/mol
Exact Mass195.05
IUPAC Name(4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride
SMILESO/N=C(\Cl)c1cccc2c1CCC2
InChIInChI=1S/C10H10ClNO/c11-10(12-13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,13H,1,3,5H2/b12-10-
InChIKeyWOFSWYCNKCLMSP-BENRWUELSA-N
XLogP2.55
TPSA32.59 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.65
LogP ≤ 52.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Fluorenone oxime
CID 16543
(E)-2,3-Dihydro-1H-inden-1-one oxime
CID 5907709
1-(2,3-dihydro-1H-inden-5-yl)ethan-1-one oxime
CID 9584670
s-Indacen-1(2H)-one, 3,5,6,7-tetrahydro-, oxime
CID 5468825
5-Acetohydroximoylindane
CID 2825047
2,3-Dihydro-1H-inden-1-one oxime
CID 302323
1-Indanone oxime
CID 5383710
(NZ)-N-(3-methyl-2,3-dihydroinden-1-ylidene)hydroxylamine
CID 5715348
(NE)-N-(3-methyl-2,3-dihydroinden-1-ylidene)hydroxylamine
CID 9584139
(1Z)-N-hydroxy-2-methylbenzenecarboximidoyl chloride
CID 12594310
(1Z)-N-hydroxy-3-methylbenzenecarboximidoyl chloride
CID 12706445
N-Hydroxy-2-methylbenzene-1-carboximidoyl chloride
CID 71403975

Frequently Asked Questions

What is the IUPAC name of (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride?
The IUPAC name of (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride (CID 155970403) is (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride.
What is the SMILES notation for (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride?
The canonical SMILES for (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride is O/N=C(\Cl)c1cccc2c1CCC2.
What is the InChIKey of (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride?
The InChIKey is WOFSWYCNKCLMSP-BENRWUELSA-N. The full InChI is InChI=1S/C10H10ClNO/c11-10(12-13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,13H,1,3,5H2/b12-10-.
What are the key properties of (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride?
(4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride has a molecular weight of 195.65 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-N-hydroxy-2,3-dihydro-1H-indene-4-carboximidoyl chloride is sourced from PubChem (CID 155970403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).