C16H24N2O5 — CID 155972625
formic acid;methyl 4-[(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]butanoate (PubChem CID 155972625) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is formic acid;methyl 4-[(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]butanoate.
| Compound Name | formic acid;methyl 4-[(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 155972625 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | formic acid;methyl 4-[(3S,4R)-3-hydroxy-4-(pyridin-2-ylmethyl)pyrrolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C[C@@H](Cc2ccccn2)[C@H](O)C1.O=CO |
| InChI | InChI=1S/C15H22N2O3.CH2O2/c1-20-15(19)6-4-8-17-10-12(14(18)11-17)9-13-5-2-3-7-16-13;2-1-3/h2-3,5,7,12,14,18H,4,6,8-11H2,1H3;1H,(H,2,3)/t12-,14-;/m1./s1 |
| InChIKey | AXZVFBLUEGEUJA-QMDUSEKHSA-N |
| XLogP | 0.57 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|