About silver 1-ethynylnaphthalene
silver 1-ethynylnaphthalene (PubChem CID 15597420) has the molecular formula C12H7Ag
and a molecular weight of 259.06 g/mol. Its IUPAC name is silver 1-ethynylnaphthalene.
Molecular Properties
| Compound Name | silver 1-ethynylnaphthalene |
| PubChem CID | 15597420 |
| Molecular Formula | C12H7Ag |
| Molecular Weight | 259.06 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | silver 1-ethynylnaphthalene |
| SMILES | [Ag+].[C-]#Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H7.Ag/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;/h3-9H;/q-1;+1 |
| InChIKey | FHJMDLFEYKJYAO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze silver 1-ethynylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 1-ethynylnaphthalene?
The IUPAC name of silver 1-ethynylnaphthalene (CID 15597420) is silver 1-ethynylnaphthalene.
What is the SMILES notation for silver 1-ethynylnaphthalene?
The canonical SMILES for silver 1-ethynylnaphthalene is [Ag+].[C-]#Cc1cccc2ccccc12.
What is the InChIKey of silver 1-ethynylnaphthalene?
The InChIKey is FHJMDLFEYKJYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7.Ag/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;/h3-9H;/q-1;+1.
What are the key properties of silver 1-ethynylnaphthalene?
silver 1-ethynylnaphthalene has a molecular weight of 259.06 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for silver 1-ethynylnaphthalene is sourced from PubChem (CID 15597420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).