About 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile
3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile (PubChem CID 155977261) has the molecular formula C23H19N7
and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile |
| PubChem CID | 155977261 |
| Molecular Formula | C23H19N7 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCC(c2ccc3cc(-c4ccncc4)cnc3n2)CC1 |
| InChI | InChI=1S/C23H19N7/c24-14-21-23(27-10-9-26-21)30-11-5-17(6-12-30)20-2-1-18-13-19(15-28-22(18)29-20)16-3-7-25-8-4-16/h1-4,7-10,13,15,17H,5-6,11-12H2 |
| InChIKey | DQCCAGGTSDYKTJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile?
The IUPAC name of 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile (CID 155977261) is 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile is N#Cc1nccnc1N1CCC(c2ccc3cc(-c4ccncc4)cnc3n2)CC1.
What is the InChIKey of 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile?
The InChIKey is DQCCAGGTSDYKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N7/c24-14-21-23(27-10-9-26-21)30-11-5-17(6-12-30)20-2-1-18-13-19(15-28-22(18)29-20)16-3-7-25-8-4-16/h1-4,7-10,13,15,17H,5-6,11-12H2.
What are the key properties of 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile?
3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile has a molecular weight of 393.45 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(6-pyridin-4-yl-1,8-naphthyridin-2-yl)piperidin-1-yl]pyrazine-2-carbonitrile is sourced from PubChem (CID 155977261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).