C8H15N5 — CID 155978110
3-methyl-1-(2H-triazol-4-ylmethyl)pyrrolidin-3-amine (PubChem CID 155978110) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-methyl-1-(2H-triazol-4-ylmethyl)pyrrolidin-3-amine.
| Compound Name | 3-methyl-1-(2H-triazol-4-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 155978110 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 3-methyl-1-(2H-triazol-4-ylmethyl)pyrrolidin-3-amine |
| SMILES | CC1(N)CCN(Cc2cn[nH]n2)C1 |
| InChI | InChI=1S/C8H15N5/c1-8(9)2-3-13(6-8)5-7-4-10-12-11-7/h4H,2-3,5-6,9H2,1H3,(H,10,11,12) |
| InChIKey | BRTMNQUOUZUYNZ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |