C7H8F4N4 — CID 154760409
4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-2H-triazole (PubChem CID 154760409) has the molecular formula C7H8F4N4 and a molecular weight of 224.16 g/mol. Its IUPAC name is 4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-2H-triazole.
| Compound Name | 4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-2H-triazole |
|---|---|
| PubChem CID | 154760409 |
| Molecular Formula | C7H8F4N4 |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-[(3,3,4,4-tetrafluoropyrrolidin-1-yl)methyl]-2H-triazole |
| SMILES | FC1(F)CN(Cc2cn[nH]n2)CC1(F)F |
| InChI | InChI=1S/C7H8F4N4/c8-6(9)3-15(4-7(6,10)11)2-5-1-12-14-13-5/h1H,2-4H2,(H,12,13,14) |
| InChIKey | LUPCXKRGUFLVPZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|