C20H22N4S — CID 155979870
1-thiophen-2-yl-N-(3,6,6-trimethyl-1-pyridin-2-yl-5,7-dihydro-4H-indazol-4-yl)methanimine (PubChem CID 155979870) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-(3,6,6-trimethyl-1-pyridin-2-yl-5,7-dihydro-4H-indazol-4-yl)methanimine.
| Compound Name | 1-thiophen-2-yl-N-(3,6,6-trimethyl-1-pyridin-2-yl-5,7-dihydro-4H-indazol-4-yl)methanimine |
|---|---|
| PubChem CID | 155979870 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-thiophen-2-yl-N-(3,6,6-trimethyl-1-pyridin-2-yl-5,7-dihydro-4H-indazol-4-yl)methanimine |
| SMILES | Cc1nn(-c2ccccn2)c2c1C(/N=C/c1cccs1)CC(C)(C)C2 |
| InChI | InChI=1S/C20H22N4S/c1-14-19-16(22-13-15-7-6-10-25-15)11-20(2,3)12-17(19)24(23-14)18-8-4-5-9-21-18/h4-10,13,16H,11-12H2,1-3H3/b22-13+ |
| InChIKey | DNIQWIXUNDSNAT-LPYMAVHISA-N |
| XLogP | 4.77 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|