C10H11N3S — CID 97179619
3,5-dimethyl-1-pyridin-2-ylpyrazole-4-thiol (PubChem CID 97179619) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-thiol.
| Compound Name | 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-thiol |
|---|---|
| PubChem CID | 97179619 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-thiol |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1S |
| InChI | InChI=1S/C10H11N3S/c1-7-10(14)8(2)13(12-7)9-5-3-4-6-11-9/h3-6,14H,1-2H3 |
| InChIKey | JPCKPYZXECWZLE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|