C29H25N3O2Sn — CID 141206427
triphenylstannyl 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxylate (PubChem CID 141206427) has the molecular formula C29H25N3O2Sn and a molecular weight of 566.25 g/mol. Its IUPAC name is triphenylstannyl 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxylate.
| Compound Name | triphenylstannyl 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 141206427 |
| Molecular Formula | C29H25N3O2Sn |
| Molecular Weight | 566.25 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | triphenylstannyl 3,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccn2)c(C)c1C(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C11H11N3O2.3C6H5.Sn/c1-7-10(11(15)16)8(2)14(13-7)9-5-3-4-6-12-9;3*1-2-4-6-5-3-1;/h3-6H,1-2H3,(H,15,16);3*1-5H;/q;;;;+1/p-1 |
| InChIKey | PYAFXSCGODCNNZ-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |