C8H8N4 — CID 154284403
2-(5-methyl-1,2,4-triazol-1-yl)pyridine (PubChem CID 154284403) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 2-(5-methyl-1,2,4-triazol-1-yl)pyridine.
| Compound Name | 2-(5-methyl-1,2,4-triazol-1-yl)pyridine |
|---|---|
| PubChem CID | 154284403 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-(5-methyl-1,2,4-triazol-1-yl)pyridine |
| SMILES | Cc1ncnn1-c1ccccn1 |
| InChI | InChI=1S/C8H8N4/c1-7-10-6-11-12(7)8-4-2-3-5-9-8/h2-6H,1H3 |
| InChIKey | GSQDXGXVNAANEE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |