C8H7ClN4 — CID 107447271
2-[5-(chloromethyl)-1,2,4-triazol-1-yl]pyridine (PubChem CID 107447271) has the molecular formula C8H7ClN4 and a molecular weight of 194.63 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]pyridine.
| Compound Name | 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]pyridine |
|---|---|
| PubChem CID | 107447271 |
| Molecular Formula | C8H7ClN4 |
| Molecular Weight | 194.63 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-[5-(chloromethyl)-1,2,4-triazol-1-yl]pyridine |
| SMILES | ClCc1ncnn1-c1ccccn1 |
| InChI | InChI=1S/C8H7ClN4/c9-5-8-11-6-12-13(8)7-3-1-2-4-10-7/h1-4,6H,5H2 |
| InChIKey | VRTWZMLOVHZXIT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.63 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|