C12H12ClN5 — CID 169041911
(2-isoquinolin-3-yl-1,2,4-triazol-3-yl)methylazanium chloride (PubChem CID 169041911) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is (2-isoquinolin-3-yl-1,2,4-triazol-3-yl)methylazanium chloride.
| Compound Name | (2-isoquinolin-3-yl-1,2,4-triazol-3-yl)methylazanium chloride |
|---|---|
| PubChem CID | 169041911 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2-isoquinolin-3-yl-1,2,4-triazol-3-yl)methylazanium chloride |
| SMILES | [Cl-].[NH3+]Cc1ncnn1-c1cc2ccccc2cn1 |
| InChI | InChI=1S/C12H11N5.ClH/c13-6-12-15-8-16-17(12)11-5-9-3-1-2-4-10(9)7-14-11;/h1-5,7-8H,6,13H2;1H |
| InChIKey | JERGRFRDDRPKSJ-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |