About 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine
6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine (PubChem CID 174145326) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine |
| PubChem CID | 174145326 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine |
| SMILES | CCc1ncnn1-c1ccc(N)cn1 |
| InChI | InChI=1S/C9H11N5/c1-2-8-12-6-13-14(8)9-4-3-7(10)5-11-9/h3-6H,2,10H2,1H3 |
| InChIKey | KBFZSVFHMOLBOO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine?
The IUPAC name of 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine (CID 174145326) is 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine.
What is the SMILES notation for 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine?
The canonical SMILES for 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine is CCc1ncnn1-c1ccc(N)cn1.
What is the InChIKey of 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine?
The InChIKey is KBFZSVFHMOLBOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c1-2-8-12-6-13-14(8)9-4-3-7(10)5-11-9/h3-6H,2,10H2,1H3.
What are the key properties of 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine?
6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine has a molecular weight of 189.22 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-ethyl-1,2,4-triazol-1-yl)pyridin-3-amine is sourced from PubChem (CID 174145326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).