C9H11N5 — CID 114287515
6-(2-ethyl-1,2,4-triazol-3-yl)pyridin-3-amine (PubChem CID 114287515) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-(2-ethyl-1,2,4-triazol-3-yl)pyridin-3-amine.
| Compound Name | 6-(2-ethyl-1,2,4-triazol-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 114287515 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-(2-ethyl-1,2,4-triazol-3-yl)pyridin-3-amine |
| SMILES | CCn1ncnc1-c1ccc(N)cn1 |
| InChI | InChI=1S/C9H11N5/c1-2-14-9(12-6-13-14)8-4-3-7(10)5-11-8/h3-6H,2,10H2,1H3 |
| InChIKey | KCOVRFDIJRFPIS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |