C9H10IN5 — CID 167507554
(1S)-1-[2-(5-iodo-2-pyridinyl)-1,2,4-triazol-3-yl]ethanamine (PubChem CID 167507554) has the molecular formula C9H10IN5 and a molecular weight of 315.12 g/mol. Its IUPAC name is (1S)-1-[2-(5-iodo-2-pyridinyl)-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | (1S)-1-[2-(5-iodo-2-pyridinyl)-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 167507554 |
| Molecular Formula | C9H10IN5 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | (1S)-1-[2-(5-iodo-2-pyridinyl)-1,2,4-triazol-3-yl]ethanamine |
| SMILES | C[C@H](N)c1ncnn1-c1ccc(I)cn1 |
| InChI | InChI=1S/C9H10IN5/c1-6(11)9-13-5-14-15(9)8-3-2-7(10)4-12-8/h2-6H,11H2,1H3/t6-/m0/s1 |
| InChIKey | FSUPCDWWVAWOLN-LURJTMIESA-N |
| XLogP | 1.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|