C10H9IN6 — CID 163283814
6-[5-(1-aminoethyl)-3-iodo-1,2,4-triazol-1-yl]pyridine-3-carbonitrile (PubChem CID 163283814) has the molecular formula C10H9IN6 and a molecular weight of 340.13 g/mol. Its IUPAC name is 6-[5-(1-aminoethyl)-3-iodo-1,2,4-triazol-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[5-(1-aminoethyl)-3-iodo-1,2,4-triazol-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163283814 |
| Molecular Formula | C10H9IN6 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 6-[5-(1-aminoethyl)-3-iodo-1,2,4-triazol-1-yl]pyridine-3-carbonitrile |
| SMILES | CC(N)c1nc(I)nn1-c1ccc(C#N)cn1 |
| InChI | InChI=1S/C10H9IN6/c1-6(13)9-15-10(11)16-17(9)8-3-2-7(4-12)5-14-8/h2-3,5-6H,13H2,1H3 |
| InChIKey | LXLZHORADSMWSJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|