C14H12Cl2N6 — CID 175779414
(1R)-1-[2-(5-chloro-2-pyridinyl)-5-(6-chloro-3-pyridinyl)-1,2,4-triazol-3-yl]ethanamine (PubChem CID 175779414) has the molecular formula C14H12Cl2N6 and a molecular weight of 335.20 g/mol. Its IUPAC name is (1R)-1-[2-(5-chloro-2-pyridinyl)-5-(6-chloro-3-pyridinyl)-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | (1R)-1-[2-(5-chloro-2-pyridinyl)-5-(6-chloro-3-pyridinyl)-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 175779414 |
| Molecular Formula | C14H12Cl2N6 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (1R)-1-[2-(5-chloro-2-pyridinyl)-5-(6-chloro-3-pyridinyl)-1,2,4-triazol-3-yl]ethanamine |
| SMILES | C[C@@H](N)c1nc(-c2ccc(Cl)nc2)nn1-c1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H12Cl2N6/c1-8(17)14-20-13(9-2-4-11(16)18-6-9)21-22(14)12-5-3-10(15)7-19-12/h2-8H,17H2,1H3/t8-/m1/s1 |
| InChIKey | WKQGFWREBKFDDZ-MRVPVSSYSA-N |
| XLogP | 3.05 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|