C8H10N4S — CID 166542000
3-(5-propan-2-yl-1,2,4-triazol-1-yl)-1,2-thiazole (PubChem CID 166542000) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 3-(5-propan-2-yl-1,2,4-triazol-1-yl)-1,2-thiazole.
| Compound Name | 3-(5-propan-2-yl-1,2,4-triazol-1-yl)-1,2-thiazole |
|---|---|
| PubChem CID | 166542000 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 3-(5-propan-2-yl-1,2,4-triazol-1-yl)-1,2-thiazole |
| SMILES | CC(C)c1ncnn1-c1ccsn1 |
| InChI | InChI=1S/C8H10N4S/c1-6(2)8-9-5-10-12(8)7-3-4-13-11-7/h3-6H,1-2H3 |
| InChIKey | ROZKQHYCABQSAH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |