C11H10N6O — CID 166878526
N-[1-[2-(4-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]formamide (PubChem CID 166878526) has the molecular formula C11H10N6O and a molecular weight of 242.24 g/mol. Its IUPAC name is N-[1-[2-(4-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]formamide.
| Compound Name | N-[1-[2-(4-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]formamide |
|---|---|
| PubChem CID | 166878526 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[1-[2-(4-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]formamide |
| SMILES | CC(NC=O)c1ncnn1-c1cc(C#N)ccn1 |
| InChI | InChI=1S/C11H10N6O/c1-8(15-7-18)11-14-6-16-17(11)10-4-9(5-12)2-3-13-10/h2-4,6-8H,1H3,(H,15,18) |
| InChIKey | ULJRPUMITMLUFJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|