C17H11F3N6O — CID 162496253
N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-3,4,5-trifluorobenzamide (PubChem CID 162496253) has the molecular formula C17H11F3N6O and a molecular weight of 372.31 g/mol. Its IUPAC name is N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 162496253 |
| Molecular Formula | C17H11F3N6O |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]-3,4,5-trifluorobenzamide |
| SMILES | C[C@H](NC(=O)c1cc(F)c(F)c(F)c1)c1ncnn1-c1ccc(C#N)cn1 |
| InChI | InChI=1S/C17H11F3N6O/c1-9(25-17(27)11-4-12(18)15(20)13(19)5-11)16-23-8-24-26(16)14-3-2-10(6-21)7-22-14/h2-5,7-9H,1H3,(H,25,27)/t9-/m0/s1 |
| InChIKey | YSPDQDPCEMGGME-VIFPVBQESA-N |
| XLogP | 2.44 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|