C16H12ClN7O — CID 164935954
6-chloro-N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]pyridine-2-carboxamide (PubChem CID 164935954) has the molecular formula C16H12ClN7O and a molecular weight of 353.77 g/mol. Its IUPAC name is 6-chloro-N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 164935954 |
| Molecular Formula | C16H12ClN7O |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 6-chloro-N-[(1S)-1-[2-(5-cyano-2-pyridinyl)-1,2,4-triazol-3-yl]ethyl]pyridine-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1cccc(Cl)n1)c1ncnn1-c1ccc(C#N)cn1 |
| InChI | InChI=1S/C16H12ClN7O/c1-10(22-16(25)12-3-2-4-13(17)23-12)15-20-9-21-24(15)14-6-5-11(7-18)8-19-14/h2-6,8-10H,1H3,(H,22,25)/t10-/m0/s1 |
| InChIKey | GDWNQHHDHZWTFD-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|