C30H26N4 — CID 155981974
4-[2,4,5-tris(4-aminophenyl)phenyl]aniline (PubChem CID 155981974) has the molecular formula C30H26N4 and a molecular weight of 442.57 g/mol. Its IUPAC name is 4-[2,4,5-tris(4-aminophenyl)phenyl]aniline.
| Compound Name | 4-[2,4,5-tris(4-aminophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 155981974 |
| Molecular Formula | C30H26N4 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 4-[2,4,5-tris(4-aminophenyl)phenyl]aniline |
| SMILES | Nc1ccc(-c2cc(-c3ccc(N)cc3)c(-c3ccc(N)cc3)cc2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C30H26N4/c31-23-9-1-19(2-10-23)27-17-29(21-5-13-25(33)14-6-21)30(22-7-15-26(34)16-8-22)18-28(27)20-3-11-24(32)12-4-20/h1-18H,31-34H2 |
| InChIKey | ZBKGCNONJIFUCB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|