C28H34N2O2 — CID 155982910
1-(cyclobutanecarbonyl)-4-[[4-(3-methylphenyl)phenyl]methyl]-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 155982910) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-(cyclobutanecarbonyl)-4-[[4-(3-methylphenyl)phenyl]methyl]-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | 1-(cyclobutanecarbonyl)-4-[[4-(3-methylphenyl)phenyl]methyl]-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 155982910 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-(cyclobutanecarbonyl)-4-[[4-(3-methylphenyl)phenyl]methyl]-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccc(-c3cccc(C)c3)cc2)CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C28H34N2O2/c1-3-16-29-27(32)28(14-17-30(18-15-28)26(31)24-7-5-8-24)20-22-10-12-23(13-11-22)25-9-4-6-21(2)19-25/h3-4,6,9-13,19,24H,1,5,7-8,14-18,20H2,2H3,(H,29,32) |
| InChIKey | MEWHYTVZTSRQBH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|