C25H32N2O2S — CID 110084027
1-(2,2-dimethylpropanoyl)-N-prop-2-enyl-4-[(3-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 110084027) has the molecular formula C25H32N2O2S and a molecular weight of 424.61 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-prop-2-enyl-4-[(3-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-prop-2-enyl-4-[(3-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110084027 |
| Molecular Formula | C25H32N2O2S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-prop-2-enyl-4-[(3-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2cccc(-c3cccs3)c2)CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H32N2O2S/c1-5-13-26-22(28)25(11-14-27(15-12-25)23(29)24(2,3)4)18-19-8-6-9-20(17-19)21-10-7-16-30-21/h5-10,16-17H,1,11-15,18H2,2-4H3,(H,26,28) |
| InChIKey | ZRRVHNNKPFRKBH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|