C26H29N3OS — CID 110083793
N-prop-2-enyl-1-(pyridin-4-ylmethyl)-4-[(4-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 110083793) has the molecular formula C26H29N3OS and a molecular weight of 431.61 g/mol. Its IUPAC name is N-prop-2-enyl-1-(pyridin-4-ylmethyl)-4-[(4-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-prop-2-enyl-1-(pyridin-4-ylmethyl)-4-[(4-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110083793 |
| Molecular Formula | C26H29N3OS |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-prop-2-enyl-1-(pyridin-4-ylmethyl)-4-[(4-thiophen-2-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccc(-c3cccs3)cc2)CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C26H29N3OS/c1-2-13-28-25(30)26(11-16-29(17-12-26)20-22-9-14-27-15-10-22)19-21-5-7-23(8-6-21)24-4-3-18-31-24/h2-10,14-15,18H,1,11-13,16-17,19-20H2,(H,28,30) |
| InChIKey | GTIVYPUVIQQHMF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|