C28H30FN3O — CID 110082403
4-[[4-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enyl-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide (PubChem CID 110082403) has the molecular formula C28H30FN3O and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[[4-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enyl-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 4-[[4-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enyl-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110082403 |
| Molecular Formula | C28H30FN3O |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 4-[[4-(2-fluorophenyl)phenyl]methyl]-N-prop-2-enyl-1-(pyridin-4-ylmethyl)piperidine-4-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccc(-c3ccccc3F)cc2)CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C28H30FN3O/c1-2-15-31-27(33)28(13-18-32(19-14-28)21-23-11-16-30-17-12-23)20-22-7-9-24(10-8-22)25-5-3-4-6-26(25)29/h2-12,16-17H,1,13-15,18-21H2,(H,31,33) |
| InChIKey | QMFFOKYAEOJLFP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|