C25H27N3O2S — CID 92548710
(2S)-N-prop-2-enyl-4-(pyridin-4-ylmethyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide (PubChem CID 92548710) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is (2S)-N-prop-2-enyl-4-(pyridin-4-ylmethyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-N-prop-2-enyl-4-(pyridin-4-ylmethyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92548710 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2S)-N-prop-2-enyl-4-(pyridin-4-ylmethyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide |
| SMILES | C=CCNC(=O)[C@]1(Cc2ccc(-c3cccs3)cc2)CN(Cc2ccncc2)CCO1 |
| InChI | InChI=1S/C25H27N3O2S/c1-2-11-27-24(29)25(17-20-5-7-22(8-6-20)23-4-3-16-31-23)19-28(14-15-30-25)18-21-9-12-26-13-10-21/h2-10,12-13,16H,1,11,14-15,17-19H2,(H,27,29)/t25-/m0/s1 |
| InChIKey | WKEYWKFFLMPDLM-VWLOTQADSA-N |
| XLogP | 3.93 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|