C22H21N3O3S — CID 92571548
(2S)-4-(pyridine-4-carbonyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide (PubChem CID 92571548) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is (2S)-4-(pyridine-4-carbonyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-(pyridine-4-carbonyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92571548 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2S)-4-(pyridine-4-carbonyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide |
| SMILES | NC(=O)[C@]1(Cc2ccc(-c3cccs3)cc2)CN(C(=O)c2ccncc2)CCO1 |
| InChI | InChI=1S/C22H21N3O3S/c23-21(27)22(14-16-3-5-17(6-4-16)19-2-1-13-29-19)15-25(11-12-28-22)20(26)18-7-9-24-10-8-18/h1-10,13H,11-12,14-15H2,(H2,23,27)/t22-/m0/s1 |
| InChIKey | QEDLZIGYBPRPTE-QFIPXVFZSA-N |
| XLogP | 2.75 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |