C25H25N3O4 — CID 92599569
(2S)-4-(3-methoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide (PubChem CID 92599569) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (2S)-4-(3-methoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-(3-methoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92599569 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2S)-4-(3-methoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide |
| SMILES | COc1cccc(C(=O)N2CCO[C@](Cc3cccc(-c4ccncc4)c3)(C(N)=O)C2)c1 |
| InChI | InChI=1S/C25H25N3O4/c1-31-22-7-3-6-21(15-22)23(29)28-12-13-32-25(17-28,24(26)30)16-18-4-2-5-20(14-18)19-8-10-27-11-9-19/h2-11,14-15H,12-13,16-17H2,1H3,(H2,26,30)/t25-/m0/s1 |
| InChIKey | RTPGWYZPHMCFKG-VWLOTQADSA-N |
| XLogP | 2.70 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |