C24H22FN3O3 — CID 92569626
(2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-4-(pyridine-3-carbonyl)morpholine-2-carboxamide (PubChem CID 92569626) has the molecular formula C24H22FN3O3 and a molecular weight of 419.46 g/mol. Its IUPAC name is (2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-4-(pyridine-3-carbonyl)morpholine-2-carboxamide.
| Compound Name | (2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-4-(pyridine-3-carbonyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92569626 |
| Molecular Formula | C24H22FN3O3 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (2R)-2-[[3-(3-fluorophenyl)phenyl]methyl]-4-(pyridine-3-carbonyl)morpholine-2-carboxamide |
| SMILES | NC(=O)[C@@]1(Cc2cccc(-c3cccc(F)c3)c2)CN(C(=O)c2cccnc2)CCO1 |
| InChI | InChI=1S/C24H22FN3O3/c25-21-8-2-6-19(13-21)18-5-1-4-17(12-18)14-24(23(26)30)16-28(10-11-31-24)22(29)20-7-3-9-27-15-20/h1-9,12-13,15H,10-11,14,16H2,(H2,26,30)/t24-/m1/s1 |
| InChIKey | GBDKCBBSLVWHAS-XMMPIXPASA-N |
| XLogP | 2.83 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |